DICOM PS3.16 2020a - Content Mapping Resource |
Page 91 |
8 Coding Schemes
Table 8-1 lists the coding schemes (and their designators) defined for use in DICOM; Table 8-2 lists the HL7v3 coding schemes ref- erenced for use in DICOM. Additionally, any coding scheme may be used that has an entry in the HL7 Registry of Coding Schemes (HL7 v2 Table 0396, or the equivalent online registry), in which case the HL7 Symbolic Name shall be used as the value for the Coding Scheme Designator in DICOM, as long as it does not conflict with an entry Table 8-1 and fits within the Value Representation of the DICOM Coding Scheme Designator (0008,0102) attribute. As specified in the HL7 v2 Table 0396, local or private coding schemes shall be identified by an alphanumeric identifier beginning with the characters "99".
Note
1.An earlier version of this table was formerly contained in Annex D of PS3.3.
2.See Section 8.2 “Coding Scheme Designator and Coding Scheme Version” in PS3.3 for further description.
3.The Coding Scheme UIDs are provided for reference only; the normative specification of UIDs and their associated meaning is the responsibility of the coding scheme developer and/or HL7.
4.The current version of HL7 v2 Table 0396 is available at http://www.hl7.org/special/committees/vocab/table_0396/ index.cfm.
5.The HL7 registration of Coding Schemes is available at http://www.hl7.org/oid/index.cfm.
6.Publication of codes or references to coding schemes within DICOM does not constitute a grant of intellectual property rightstoimplementers.UseofsomeCodingSchemesmayrequirealicense,orpurchaseoftherelevantcodingscheme publication. Implementers should consult the relevant coding scheme publisher; see also Section 2.
7.The values of Coding Scheme Name (0008,0115), Coding Scheme Responsible Organization (0008,0116) and Coding Scheme Resources Sequence (0008,0109), if available, may be used to fill the corresponding optional attributes of the Coding Scheme Identification Sequence (0008,0110) in the Section C.12.1 “SOP Common Module” in PS3.3.
Table 8-1. Coding Schemes
Coding Scheme Coding Scheme UID CodingScheme Coding |
Coding Scheme |
Description |
|||
Designator |
(0008,010C) |
Name |
Scheme |
Resources Sequence |
|
(0008,0102) |
|
(0008,0115) Responsible (0008,0109) Type: URL |
|
||
|
|
|
Organization |
|
|
|
|
|
(0008,0116) |
|
|
ACR |
2.16.840.1.113883.6.76 ACR Index |
ACR |
|
ACR Index for Radiological |
|
|
|
|
|
|
DiagnosisRevised,3rd Edition |
|
|
|
|
|
1986 |
ASTM-sigpurpose1.2.840.10065.1.12 |
ASTM E 2084 ASTM |
|
[ASTM E 2084-00] Signature |
||
|
|
|
|
|
Purposecodes(seeAnnexA1 |
|
|
|
|
|
of ASTM E 2084), ASTM |
|
|
|
|
|
Subcommittee E 31.20 Data |
|
|
|
|
|
and System Security for |
|
|
|
|
|
Health Information |
BARI |
|
BARI |
|
|
Bypass Angioplasty |
|
|
|
|
|
Revascularization |
|
|
|
|
|
Investigation[Alderman1992]; |
|
|
|
|
|
endorsed by ACC/AHA |
|
|
|
|
|
Guidelines for Coronary |
|
|
|
|
|
Angiography[Scanlon 1999]. |
- Standard -
Page 92 |
DICOM PS3.16 2020a - Content Mapping Resource |
|
|||
Coding Scheme Coding Scheme UID CodingScheme Coding |
Coding Scheme |
Description |
|||
Designator |
(0008,010C) |
Name |
Scheme |
Resources Sequence |
|
(0008,0102) |
|
(0008,0115) Responsible (0008,0109) Type: URL |
|
||
|
|
|
Organization |
|
|
|
|
|
(0008,0116) |
|
|
BI |
|
BI-RADS |
ACR |
|
ACR Breast Imaging |
|
|
|
|
|
Reporting and Data System |
|
|
|
|
|
[BI-RADS®], Coding Scheme |
|
|
|
|
|
Version (0008,0103) is |
|
|
|
|
|
required; code values are |
|
|
|
|
|
section and paragraph |
|
|
|
|
|
identifiers within the |
|
|
|
|
|
publication where the code |
|
|
|
|
|
meaning is defined (e.g., |
|
|
|
|
|
"I.D.1", where I = Breast |
|
|
|
|
|
Imaging Lexicon, D = Special |
|
|
|
|
|
Cases, 1 = Tubular Density, |
|
|
|
|
|
asthecodevaluefor"Tubular |
|
|
|
|
|
Density"). |
|
|
|
|
|
Note |
|
|
|
|
|
In the HL7 registry, |
|
|
|
|
|
theabbreviationBIis |
|
|
|
|
|
assigned to a |
|
|
|
|
|
different coding |
|
|
|
|
|
scheme, specifically |
|
|
|
|
|
the Beth Israel |
|
|
|
|
|
problem list. |
C4 |
2.16.840.1.113883.6.12 CPT-4 |
AMA |
|
American Medical |
|
|
|
|
|
|
Association's Current |
|
|
|
|
|
Procedure Terminology 4 |
|
|
|
|
|
(CPT-4) |
C5 |
2.16.840.1.113883.6.82 CPT-5 |
AMA |
|
American Medical |
|
|
|
|
|
|
Association's Current |
|
|
|
|
|
Procedure Terminology 5 |
|
|
|
|
|
(CPT-5) |
caDSR |
2.16.840.1.113883.3.26.2Cancer Data |
NCI |
|
The Public ID is used as the |
|
|
|
Standard |
|
|
Code Value. |
|
|
Repository |
|
|
These can be looked up as in |
|
|
|
|
|
|
|
|
|
|
|
the following example (the |
|
|
|
|
|
version is required): http:// |
|
|
|
|
|
cdebrowser.nci.nih.gov/ |
|
|
|
|
|
CDEBrowser/search? |
|
|
|
|
|
dataElementDetails=9/ |
|
|
|
|
|
&cdeId=2178693&version=2.1 |
|
|
|
|
|
&PageId=DataElementsGroup |
CD2 |
2.16.840.1.113883.6.13 CDT-2 |
ADA |
|
AmericanDentalAssociation's |
|
|
|
|
|
|
(ADA) Current Dental |
|
|
|
|
|
Terminology 2 (CDT-2) |
CTV3 |
2.16.840.1.113883.6.6 |
Clinical Terms UK NHS |
|
Read Codes |
|
|
|
Version 3 |
|
|
|
- Standard -
|
DICOM PS3.16 2020a - Content Mapping Resource |
Page 93 |
|||
Coding Scheme Coding Scheme UID CodingScheme Coding |
Coding Scheme |
Description |
|||
Designator |
(0008,010C) |
Name |
Scheme |
Resources Sequence |
|
(0008,0102) |
|
(0008,0115) Responsible (0008,0109) Type: URL |
|
||
|
|
|
Organization |
|
|
|
|
|
(0008,0116) |
|
|
DC |
1.2.840.10008.2.16.10 |
Dublin Core |
W3C |
DOC: http://dublincore.org/Dublin Code Metadata for |
|
|
|
|
|
documents/1998/09/dces/Resource Discovery. The |
|
|
|
|
|
|
code value is the Label field, |
|
|
|
|
DOC:http://www.ietf.org/rfc/ |
|
|
|
|
|
rfc2413.txt |
e.g., "Creator" (capitalization |
|
|
|
|
significant). |
|
DCM |
1.2.840.10008.2.16.4 |
DICOM |
DICOM |
DOC: http://dicom.nema. |
PS3.16 Content Mapping |
|
|
Controlled |
|
org/medical/dicom/current/Resource,AnnexD(Notethat |
|
|
|
Terminology |
|
output/chtml/part16/ |
HL7 also specifies an OID of |
|
|
|
|
chapter_D.html |
2.16.840.1.113883.6.31, but |
|
|
|
|
|
deprecates it in favor of |
|
|
|
|
OWL: ftp://medical.nema. 1.2.840.10008.2.16.4). |
|
|
|
|
|
org/medical/dicom/current/ |
|
|
|
|
|
ontology/dcm.owl.zip |
|
DCMUID |
1.2.840.10008.2.6.1 |
DICOM UID |
DICOM |
DOC: http://dicom.nema. |
|
|
|
Registry |
|
org/medical/dicom/current/ |
|
|
|
|
|
output/chtml/part06/ |
|
|
|
|
|
chapter_A.html |
|
FMA |
2.16.840.1.113883.6.119FMA |
University ofDOC: http://sig.biostr. |
DigitalAnatomistFoundational |
||
|
|
|
Washington,washington.edu/projects/fm/Model of Anatomy |
||
|
|
|
Seattle |
AboutFM.html |
|
|
|
|
|
OWL: http://sig.biostr. |
|
|
|
|
|
washington.edu/share/ |
|
|
|
|
|
downloads/fma/release/ |
|
|
|
|
|
latest/fma.zip |
|
HPC |
2.16.840.1.113883.6.14 |
|
|
|
Healthcare Financing |
|
|
|
|
|
Administration (HCFA) |
|
|
|
|
|
Common Procedure Coding |
|
|
|
|
|
System (HCPCS) |
I10 |
2.16.840.1.113883.6.3 |
ICD-10 |
WHO |
|
International Classification of |
|
|
|
|
|
Diseasesrevision10(ICD-10) |
I10P |
2.16.840.1.113883.6.4 |
ICD-10-PCS |
US DHHS |
|
ICD-10 Procedure Coding |
|
|
|
CMS |
|
System (ICD 10 PCS) |
I11 |
1.2.840.10008.2.16.10 |
ICD-11 |
WHO |
DOC: http://icd.who.int/ |
International Classification of |
|
|
|
|
browse11/l-m/en |
Diseasesrevision11(ICD-11) |
I9 |
2.16.840.1.113883.6.42 ICD-9 |
WHO |
|
International Classification of |
|
|
|
|
|
|
Diseases revision 9 (ICD-9) |
I9C |
2.16.840.1.113883.6.2 |
ICD-9-CM |
|
|
International Classification of |
|
|
|
|
|
Diseases revision 9, with |
|
|
|
|
|
Clinical Modifications |
|
|
|
|
|
(ICD-9-CM) |
IBSI |
1.2.840.10008.2.16.13 |
Image |
|
DOC: http://arxiv.org/abs/ |
|
|
|
Biomarker |
|
1612.07003 |
|
|
|
Standardisation |
|
|
|
|
|
Initiative |
|
|
|
- Standard -
Page 94 |
DICOM PS3.16 2020a - Content Mapping Resource |
|
|||
Coding Scheme Coding Scheme UID CodingScheme Coding |
Coding Scheme |
Description |
|||
Designator |
(0008,010C) |
Name |
Scheme |
Resources Sequence |
|
(0008,0102) |
|
(0008,0115) Responsible (0008,0109) Type: URL |
|
||
|
|
|
Organization |
|
|
|
|
|
(0008,0116) |
|
|
IETF4646 |
|
RFC 4646 |
IETF |
DOC: http://tools.ietf.org/ |
[RFC 4646], Tags for |
|
|
|
|
html/rfc4646 |
Identifying Languages, The |
|
|
|
|
|
Internet Society (2005) |
|
|
|
|
|
[RFC 4646] has been |
|
|
|
|
|
superceded by [RFC 5646]. |
ISO639_1 |
2.16.840.1.113883.6.99 ISO 639-1 |
ISO |
|
[ISO 639-1] Two-letter |
|
|
|
|
|
|
language codes |
|
|
|
|
Note |
|
|
|
|
HL7 uses |
|
|
|
|
"ISO639-1" for the |
|
|
|
|
symbolic name, with |
|
|
|
|
ahyphenratherthan |
|
|
|
|
an underscore |
ISO639_2 |
2.16.840.1.113883.6.100ISO 639-2 |
ISO |
[ISO 639-2] Three-letter |
|
|
|
|
|
language codes |
|
|
|
|
Note |
|
|
|
|
HL7 uses |
|
|
|
|
"ISO639-2" for the |
|
|
|
|
symbolic name, with |
|
|
|
|
ahyphenratherthan |
|
|
|
|
an underscore |
ISO3166_1 |
2.16.1 |
ISO 3166-1 |
ISO |
[ISO 3166-1] alpha-2 Country |
|
|
|
|
Codes |
|
|
|
|
Note |
|
|
|
|
HL7 uses |
|
|
|
|
"ISO3166-1" for the |
|
|
|
|
symbolic name, with |
|
|
|
|
ahyphenratherthan |
|
|
|
|
an underscore |
ISO5218_1 |
|
ISO 5218-1 |
ISO |
Representation of Human |
|
|
|
|
Sexes (not used) |
ISO5218_1, which uses numeric codes, was improperly specified in CID 7455 Sex in earlier editions of the Standard. The alphabetic codes improperly attributed to thatcodingschemehavebeen added to the DICOM Controlled Terminology, and thus all references to coding schemeISO5218_1shouldbe considered equivalent to coding scheme DCM.
- Standard -
|
DICOM PS3.16 2020a - Content Mapping Resource |
Page 95 |
|||
Coding Scheme Coding Scheme UID CodingScheme Coding |
Coding Scheme |
Description |
|||
Designator |
(0008,010C) |
Name |
Scheme |
Resources Sequence |
|
(0008,0102) |
|
(0008,0115) Responsible (0008,0109) Type: URL |
|
||
|
|
|
Organization |
|
|
|
|
|
(0008,0116) |
|
|
ISO_OID |
|
ISO OID |
ISO |
|
[ISO8824-1]ISO/IEC8824-1- |
|
|
|
|
|
Information Technology - |
|
|
|
|
|
Abstract Syntax 1 (ASN.1): |
|
|
|
|
|
Specification of Basic |
|
|
|
|
|
Notation, and [ISO 9834-1] - |
|
|
|
|
|
Informationtechnology-Open |
|
|
|
|
|
Systems Interconnection - |
|
|
|
|
|
Procedures for the operation |
|
|
|
|
|
of OSI Registration |
|
|
|
|
|
Authorities: General |
|
|
|
|
|
proceduresandtoparcsofthe |
|
|
|
|
|
ASN.1 Object Identifier tree |
ITIS_TSN |
1.2.840.10008.2.16.7 |
ITIS TSN |
ITIS |
DOC: http://www.itis.gov |
A Taxonomic Serial Number |
|
|
|
|
|
(TSN) is a unique, persistent, |
|
|
|
|
|
non-intelligent identifier for a |
|
|
|
|
|
scientific name in the context |
|
|
|
|
|
of the Integrated Taxonomic |
|
|
|
|
|
Information System (ITIS). |
LN |
2.16.840.1.113883.6.1 |
LOINC |
Regenstrief DOC: http://loinc.org/ |
[LOINC] Logical Observation |
|
|
|
|
Institute |
|
Identifier Names and Codes |
MA |
1.2.840.10008.2.16.5 |
Adult Mouse |
The JacksonDOC: http://www. |
Hayamizu TF, Mangan M, |
|
|
|
Anatomy |
Laboratory |
informatics.jax.org/ |
Corradi JP, Kadin JA, |
|
|
Ontology |
|
searches/AMA.cgi? |
RingwaldM.TheAdultMouse |
|
|
|
|
id=MA:0002405 |
Anatomical Dictionary: a tool |
|
|
|
|
|
for annotating and integrating |
|
|
|
|
|
data. Genome Biology |
|
|
|
|
|
2005;6(3):R29. |
|
|
|
|
|
doi:10.1186/gb-2005-6-3-r29. |
|
|
|
|
|
http://www.ncbi.nlm.nih.gov/ |
|
|
|
|
|
pmc/articles/PMC1088948/ |
MAYOASRG 1.2.840.10008.2.16.12 |
Mayo Clinic |
|
|
The numeric code of entries |
|
|
|
Non-radiological |
|
in the Mayo Clinic |
|
|
|
Images Specific |
|
Non-radiological Images |
|
|
|
Body Structure |
|
|
Specific Body Structure |
|
|
Anatomical |
|
|
Anatomical Surface Region |
|
|
Surface Region |
|
Guide. |
|
|
|
Guide |
|
|
|
MDC |
2.16.840.1.113883.6.24 |
|
|
|
ISO/IEEE 11073 Medical |
|
|
|
|
|
Device Nomenclature, |
|
|
|
|
|
including all its subsections |
|
|
|
|
|
([ISO/IEEE 11073-10101], |
|
|
|
|
|
[ISO/IEEE 11073-10101a], |
|
|
|
|
|
[ISO/IEEE 11073-10102], |
|
|
|
|
|
etc.), encoded as decimal |
|
|
|
|
|
strings <partition>:<element> |
MDNS |
|
|
|
|
Universal Medical Device |
|
|
|
|
|
(UMD) Nomenclature System |
MGI |
1.2.840.10008.2.16.8 |
MGI |
The JacksonDOC: http://www. |
The MGI ID from the Mouse |
|
|
|
|
Laboratory |
informatics.jax.org/ |
Genome Initiative (MGI) |
|
|
|
|
mgihome/nomen/ |
nomenclature. |
- Standard -